Introduction:Basic information about CAS 2062-20-6|dimethyl dodecafluorosuberate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dimethyl dodecafluorosuberate |
|---|
| CAS Number | 2062-20-6 | Molecular Weight | 418.13300 |
|---|
| Density | 1,635 g/cm3 | Boiling Point | 152°C 60mm |
|---|
| Molecular Formula | C10H6F12O4 | Melting Point | 26°C |
|---|
| MSDS | / | Flash Point | 152°C/60mm |
|---|
Names
| Name | dimethyl 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1,635 g/cm3 |
|---|
| Boiling Point | 152°C 60mm |
|---|
| Melting Point | 26°C |
|---|
| Molecular Formula | C10H6F12O4 |
|---|
| Molecular Weight | 418.13300 |
|---|
| Flash Point | 152°C/60mm |
|---|
| Exact Mass | 418.00700 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 3.14420 |
|---|
| Vapour Pressure | 0.0571mmHg at 25°C |
|---|
| Index of Refraction | 1.3425 |
|---|
| InChIKey | SLFDDMXEAUAENU-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)OC |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2917190090 |
|---|
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Dimethyl dodecafluorosuberate |
| Octanedioic acid dodecafluorodimethylester |
| Perfluorhexan-1.6-dicarbonsaeure-dimethylester |
| MFCD00044088 |
| Dimethyl-dodecafluor-octandioat |
| Dimethyl dodecafluorooctanedioate |
| Dimethyl perfluorosuberate |
| Perfluorkorksaeure-dimethylester |