Introduction:Basic information about CAS 26131-32-8|Methyl perfluoro-2,5-dimethyl-3,6-dioxanonanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl perfluoro-2,5-dimethyl-3,6-dioxanonanoate |
|---|
| CAS Number | 26131-32-8 | Molecular Weight | 510.10100 |
|---|
| Density | / | Boiling Point | 155ºC |
|---|
| Molecular Formula | C10H3F17O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 104.5ºC |
|---|
Names
| Name | methyl 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 155ºC |
|---|
| Molecular Formula | C10H3F17O4 |
|---|
| Molecular Weight | 510.10100 |
|---|
| Flash Point | 104.5ºC |
|---|
| Exact Mass | 509.97600 |
|---|
| PSA | 44.76000 |
|---|
| LogP | 5.03200 |
|---|
| Vapour Pressure | 0.0173mmHg at 25°C |
|---|
| Index of Refraction | 1.297 |
|---|
| InChIKey | UMADKHFVSXRTGY-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Safety Phrases | S23-S24/25 |
|---|
Synonyms
| Methyl 2,3,3,3-tetrafluoro-2-(1,1,2,3,3,3-hexafluoro-2-(perfluoropropoxy)propoxy)propanoate |
| Perfluoro-2,5-dimethyl-3,6-dioxanonanoic acid methyl ester |
| Methyl 2,5-Bis(trifluoromethyl)-3,6-dioxaundecafluorononanoate |
| PC5979N |
| 2,5-Bis(trifluoromethyl)-3,6-dioxaundecafluorononanoic Acid Methyl Ester |
| 2'-perfluoropropoxy-2-perfluoropropoxyperfluoropropanoic acid methyl ester |
| MFCD00054723 |