Introduction：Basic information about CAS 15052-19-4|1-phenyl-1h-tetrazole-5-thiol sodium salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-phenyl-1h-tetrazole-5-thiol sodium salt |
|---|
| CAS Number | 15052-19-4 | Molecular Weight | 200.19600 |
|---|
| Density | / | Boiling Point | 340.2ºC at 760mmHg |
|---|
| Molecular Formula | C7H5N4NaS | Melting Point | >300ºC(lit.) |
|---|
| MSDS | / | Flash Point | 159.5ºC |
|---|
Names
| Name | 1-phenyl-1h-tetrazole-5-thiol sodium salt |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 340.2ºC at 760mmHg |
|---|
| Melting Point | >300ºC(lit.) |
|---|
| Molecular Formula | C7H5N4NaS |
|---|
| Molecular Weight | 200.19600 |
|---|
| Flash Point | 159.5ºC |
|---|
| Exact Mass | 200.01300 |
|---|
| PSA | 68.90000 |
|---|
| LogP | 1.21870 |
|---|
| Vapour Pressure | 8.74E-05mmHg at 25°C |
|---|
| InChIKey | RSZMKAPXKXEWBY-UHFFFAOYSA-M |
|---|
| SMILES | S=c1[n-]nnn1-c1ccccc1.[Na+] |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,2-dihydro-1-phenyl-5h-tetrazole-5-thionsodiumsalt |
| EINECS 239-121-0 |
| 1-Phenyl-5-(sodiothio)-1H-tetrazole |
| sodium 1-phenyltetrazole-5-thiolate |
| Sodium 1,2-dihydro-1-phenyl-5H-tetrazole-5-thiolate |
| MFCD00051320 |
| phenyl-1H-tetrazole-5-thiol sodium salt |
| 5-mercapto-1-phenyl-1H-tetrazole sodium salt |
| sodium 1-phenyl-1H-tetrazole-5-thiolate |
| 1-phenyl-5-mercaptotetrazole sodium salt |
| sodium 1-phenyl-1,2,3,4-tetrazole-5-thiolate |
