Introduction：Basic information about CAS 1920-66-7|2-chloro-5-nitropyrimidin-4-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-chloro-5-nitropyrimidin-4-amine |
|---|
| CAS Number | 1920-66-7 | Molecular Weight | 174.545 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 446.0±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C4H3ClN4O2 | Melting Point | 221-226ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 223.5±23.2 °C |
|---|
| Symbol |
GHS07, GHS08 | Signal Word | Danger |
|---|
Names
| Name | 2-chloro-5-nitropyrimidin-4-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 446.0±25.0 °C at 760 mmHg |
|---|
| Melting Point | 221-226ºC |
|---|
| Molecular Formula | C4H3ClN4O2 |
|---|
| Molecular Weight | 174.545 |
|---|
| Flash Point | 223.5±23.2 °C |
|---|
| Exact Mass | 173.994446 |
|---|
| PSA | 97.62000 |
|---|
| LogP | 1.94 |
|---|
| Appearance of Characters | Solid |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.671 |
|---|
| InChIKey | RZGOEIWDMVQJBQ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1nc(Cl)ncc1[N+](=O)[O-] |
|---|
| Water Solubility | Slightly soluble in water. |
|---|
Safety Information
| Symbol |
GHS07, GHS08 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H315-H319-H334-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338-P342 + P311 |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22-36/37/38-43 |
|---|
| Safety Phrases | 26-36/37-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-Amino-2-chloro-5-nitropyrimidine |
| 2-chloro-4-amino-5-nitro-pyrimidine |
| 4-Pyrimidinamine,2-chloro-5-nitro |
| 2-Chloro-5-nitropyrimidin-4-amine |
| 2-Chlor-5-nitro-pyrimidin-4-ylamin |
| 2-Chloro-5-nitro-pyrimidin-4-ylamine |
| EINECS 217-648-7 |
| 4-pyrimidinamine, 2-chloro-5-nitro- |
| 4-amino-5-nitro-2-chloropyrimidine |
| MFCD00127771 |
| 2-Chloro-5-Nitro-4-Pyrimidinamine |
| F1930-0037 |
