Introduction：Basic information about CAS 214470-68-5|4-Chloro-7-(3-chloropropoxy)-3-cyano-6-methoxyquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-7-(3-chloropropoxy)-3-cyano-6-methoxyquinoline |
|---|
| CAS Number | 214470-68-5 | Molecular Weight | 311.163 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 478.1±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12Cl2N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 243.0±27.3 °C |
|---|
Names
| Name | 4-Chloro-7-(3-chloropropoxy)-6-methoxyquinoline-3-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 478.1±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12Cl2N2O2 |
|---|
| Molecular Weight | 311.163 |
|---|
| Flash Point | 243.0±27.3 °C |
|---|
| Exact Mass | 310.027588 |
|---|
| PSA | 55.14000 |
|---|
| LogP | 3.38 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | BEGHZKYNLSIHIA-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2c(Cl)c(C#N)cnc2cc1OCCCCl |
|---|
Synonyms
| 4-Chloro-7-(3-chloropropoxy)-6-methoxy-3-quinolinecarbonitrile |
| 4-chloro-7-(3-chloropropoxy)-6-methoxyquinoline-3-carbonitrile |
| 7-(3-chloro-propoxy)-4-chloro-6-methoxy-quinoline-3-carbonitrile |
| 4-chloro-7-[3-chloropropoxy]-3-cyano-6-methoxyquinoline |
| 4-chloro-3-cyano-6-methoxy-7-(3-chloropropoxy)quinoline |
| QC-1110 |
| 3-Quinolinecarbonitrile,4-chloro-7-(3-chloropropoxy)-6-methoxy |
| 4-Chlor-7-(3-chlorpropoxy)-6-methoxychinolin-3-carbonitril |
| 4-CHLORO-7-(3-CHLORO-PROPOXY)-6-METHOXY-QUINOLINE-3-CARBONITRILE |
| 3-Quinolinecarbonitrile, 4-chloro-7-(3-chloropropoxy)-6-methoxy- |
