Introduction：Basic information about CAS 53823-70-4|D-Fructose, 1-(dihydrogen phosphate), barium salt (1:1), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | D-Fructose, 1-(dihydrogen phosphate), barium salt (1:1) |
|---|
| CAS Number | 53823-70-4 | Molecular Weight | 395.447 |
|---|
| Density | / | Boiling Point | 692.5ºC at 760mmHg |
|---|
| Molecular Formula | C6H11BaO9P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 372.6ºC |
|---|
Names
| Name | Fructose 1-Phosphate Barium Salt Trihydrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 692.5ºC at 760mmHg |
|---|
| Molecular Formula | C6H11BaO9P |
|---|
| Molecular Weight | 395.447 |
|---|
| Flash Point | 372.6ºC |
|---|
| Exact Mass | 395.919312 |
|---|
| PSA | 172.38000 |
|---|
| Appearance of Characters | crystalline |
|---|
| InChIKey | PVYXSCGRJSOHGH-BAOOBMCLSA-L |
|---|
| SMILES | O=C(COP(=O)([O-])[O-])C(O)C(O)C(O)CO.[Ba+2] |
|---|
| Storage condition | −20°C |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 20/22 |
|---|
| Safety Phrases | 28 |
|---|
| WGK Germany | 1 |
|---|
Synonyms
| Fructose 1-Phosphate BariuM Salt Trihydrate |
| [1-O-Phosphono-κO,O'hex-2-ulofuranosato(2-)]barium |
| EINECS 258-811-2 |
| MFCD00037899 |
| Barium, [2-hexulofuranosato(2-), 1-O-phosphono-κO,κO'-]- |
| Fructose-1-phosphate Barium Salt Trihydrate |
| D-Fructose, 1-(dihydrogen phosphate), barium salt (1:1) |
