Introduction：Basic information about CAS 53714-39-9|Bis[3,5-dibromo-4-(2-hydroxyethoxy)phenyl] Sulfone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis[3,5-dibromo-4-(2-hydroxyethoxy)phenyl] Sulfone |
|---|
| CAS Number | 53714-39-9 | Molecular Weight | 653.960 |
|---|
| Density | 2.1±0.1 g/cm3 | Boiling Point | 700.8±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H14Br4O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 377.6±32.9 °C |
|---|
Names
| Name | Bis[4-(2-hydroxyethoxy)-3,5-dibromophenyl] Sulfone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.1±0.1 g/cm3 |
|---|
| Boiling Point | 700.8±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H14Br4O6S |
|---|
| Molecular Weight | 653.960 |
|---|
| Flash Point | 377.6±32.9 °C |
|---|
| Exact Mass | 649.724426 |
|---|
| PSA | 101.44000 |
|---|
| LogP | 3.39 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.650 |
|---|
| InChIKey | OFBQIWFJRDGFEK-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(c1cc(Br)c(OCCO)c(Br)c1)c1cc(Br)c(OCCO)c(Br)c1 |
|---|
Synonyms
| Bis[3,5-dibroMo-4-(2-hydroxyethoxy)phenyl] Sulfone |
| 2,2'-(Sulphonylbis((2,6-dibromo-4,1-phenylene)oxy))bisethanol |
| 2,2'-{Sulfonylbis[(3,5-dibromo-4,1-phenylene)oxy]}diethanol |
| EINECS 258-709-8 |
| Ethanol, 2,2'-[sulfonylbis[(2,6-dibromo-4,1-phenylene)oxy]]bis- |
| 2,2'-{Sulfonylbis[(2,6-dibromo-4,1-phenylene)oxy]}diethanol |
| 2-[2,6-dibromo-4-[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]sulfonylphenoxy]ethanol |
| Ethanol, 2,2'-[sulfonylbis[(3,5-dibromo-4,1-phenylene)oxy]]bis- |
