Introduction：Basic information about CAS 2159-40-2|2-(4-bromobenzoyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-bromobenzoyl)benzoic acid |
|---|
| CAS Number | 2159-40-2 | Molecular Weight | 305.12300 |
|---|
| Density | 1.554g/cm3 | Boiling Point | 482.7ºC at 760mmHg |
|---|
| Molecular Formula | C14H9BrO3 | Melting Point | 158ºC |
|---|
| MSDS | / | Flash Point | 245.7ºC |
|---|
Names
| Name | 2-(4-bromobenzoyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.554g/cm3 |
|---|
| Boiling Point | 482.7ºC at 760mmHg |
|---|
| Melting Point | 158ºC |
|---|
| Molecular Formula | C14H9BrO3 |
|---|
| Molecular Weight | 305.12300 |
|---|
| Flash Point | 245.7ºC |
|---|
| Exact Mass | 303.97400 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 3.37830 |
|---|
| Vapour Pressure | 3.96E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | NONNFIAFWRSPPY-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccccc1C(=O)c1ccc(Br)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4'-bromo-o-benzoylbenzoic acid |
| F0346-0674 |
