Introduction:Basic information about CAS 7512-77-8|Glycine,N-(4-nitrobenzoyl)-, ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Glycine,N-(4-nitrobenzoyl)-, ethyl ester |
|---|
| CAS Number | 7512-77-8 | Molecular Weight | 252.22300 |
|---|
| Density | 1.295g/cm3 | Boiling Point | 454ºC at 760mmHg |
|---|
| Molecular Formula | C11H12N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 228.4ºC |
|---|
Names
| Name | ethyl 2-[(4-nitrobenzoyl)amino]acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.295g/cm3 |
|---|
| Boiling Point | 454ºC at 760mmHg |
|---|
| Molecular Formula | C11H12N2O5 |
|---|
| Molecular Weight | 252.22300 |
|---|
| Flash Point | 228.4ºC |
|---|
| Exact Mass | 252.07500 |
|---|
| PSA | 101.22000 |
|---|
| LogP | 1.80180 |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | FGQTXDKZTAZFRS-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CNC(=O)c1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-Nitro-benzaminoessigsaeureaethylester |
| ethyl 2-[(4-nitrophenyl)formamido]acetate |
| ethylnitrobenzoylaminoacetate |
| N-(4-Nitro-benzoyl)-glycin-aethylester |
| 4-Nitro-hippursaeure-aethylester |
| ethyl 2-(4-nitrobenzamido)acetate |
| ethyl 4-nitro-benzamidoacetate |
| N-(4-nitro-benzoyl)-glycine ethyl ester |
| ethyl p-nitrohippurate |