Introduction：Basic information about CAS 20916-70-5|Benzamide,4-(1,1-dimethylethyl)-N,N-diethyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzamide,4-(1,1-dimethylethyl)-N,N-diethyl- |
|---|
| CAS Number | 20916-70-5 | Molecular Weight | 233.34900 |
|---|
| Density | 0.954g/cm3 | Boiling Point | 347.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H23NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 148.7ºC |
|---|
Names
| Name | 4-tert-butyl-N,N-diethylbenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.954g/cm3 |
|---|
| Boiling Point | 347.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H23NO |
|---|
| Molecular Weight | 233.34900 |
|---|
| Flash Point | 148.7ºC |
|---|
| Exact Mass | 233.17800 |
|---|
| PSA | 20.31000 |
|---|
| LogP | 3.46610 |
|---|
| Vapour Pressure | 5.24E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.503 |
|---|
| InChIKey | FLFTZNPKRQQMIP-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)C(=O)c1ccc(C(C)(C)C)cc1 |
|---|
Synonyms
| HMS1787P16 |
| N,N-diethyl-4-tert-butylbenzamide |
| Benzamide,4-(1,1-dimethylethyl)-N,N-diethyl |
| 4-tert.-Butyl-benzoesaeure-N,N-diethylamid |
