Introduction：Basic information about CAS 7509-10-6|1,2-dimethoxy-5-methyl-3,4-dinitro-benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-dimethoxy-5-methyl-3,4-dinitro-benzene |
|---|
| CAS Number | 7509-10-6 | Molecular Weight | 242.18500 |
|---|
| Density | 1.365g/cm3 | Boiling Point | 421.3ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 203.7ºC |
|---|
Names
| Name | 1,2-dimethoxy-5-methyl-3,4-dinitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.365g/cm3 |
|---|
| Boiling Point | 421.3ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10N2O6 |
|---|
| Molecular Weight | 242.18500 |
|---|
| Flash Point | 203.7ºC |
|---|
| Exact Mass | 242.05400 |
|---|
| PSA | 110.10000 |
|---|
| LogP | 2.87500 |
|---|
| Index of Refraction | 1.561 |
|---|
| InChIKey | MZJZABWSIXCWBX-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C)c([N+](=O)[O-])c([N+](=O)[O-])c1OC |
|---|
Synonyms
| 5.6-Dinitro-homoveratrol |
| 4,5-Dimethoxy-2,3-dinitro-toluol |
| 3,4-Dimethoxy-5,6-dinitro-toluol |
| 4,5-dimethoxy-2,3-dinitro-toluene |
