Introduction:Basic information about CAS 2621-99-0|N-[4-(Aminosulfonyl)phenyl]acrylamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[4-(Aminosulfonyl)phenyl]acrylamide |
|---|
| CAS Number | 2621-99-0 | Molecular Weight | 226.25200 |
|---|
| Density | 1.387g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C9H10N2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-(4-sulfamoylphenyl)prop-2-enamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.387g/cm3 |
|---|
| Molecular Formula | C9H10N2O3S |
|---|
| Molecular Weight | 226.25200 |
|---|
| Exact Mass | 226.04100 |
|---|
| PSA | 97.64000 |
|---|
| LogP | 2.31260 |
|---|
| Index of Refraction | 1.611 |
|---|
| InChIKey | RINSWHLCRAFXEY-UHFFFAOYSA-N |
|---|
| SMILES | C=CC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| EINECS 220-066-6 |
| N-<4-(Sulfamoyl)-phenyl>-acrylamid |
| 4-Sulfamoyl-N-acryloyl-anilin |
| N-acryloyl-sulfanilic acid amide |
| n-(4-sulfamoylphenyl)acrylamide |
| N-[4-(aminosulfonyl)phenyl]acrylamide |
| N-Acryloyl-sulfanilsaeure-amid |