Introduction：Basic information about CAS 20165-81-5|diethyl 2,2-dichloropropanedioate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | diethyl 2,2-dichloropropanedioate |
|---|
| CAS Number | 20165-81-5 | Molecular Weight | 229.05800 |
|---|
| Density | 1.317g/cm3 | Boiling Point | 230ºC at 760 mmHg |
|---|
| Molecular Formula | C7H10Cl2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 85ºC |
|---|
Names
| Name | diethyl 2,2-dichloropropanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.317g/cm3 |
|---|
| Boiling Point | 230ºC at 760 mmHg |
|---|
| Molecular Formula | C7H10Cl2O4 |
|---|
| Molecular Weight | 229.05800 |
|---|
| Flash Point | 85ºC |
|---|
| Exact Mass | 227.99600 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 1.28650 |
|---|
| Vapour Pressure | 0.0673mmHg at 25°C |
|---|
| Index of Refraction | 1.46 |
|---|
| InChIKey | QVRUXRSUYSWFJN-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(Cl)(Cl)C(=O)OCC |
|---|
Safety Information
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2,2-dichloromalonic acid diethyl ester |
| EINECS 243-550-9 |
| Cl2C(CO2Et)2 |
| diethyl 2,2-dichloromalonate |
| Diethyl dichloromalonate |
| dichloromalonic acid diethyl ester |
| Dichlor-malonsaeure-diaethylester |
