Introduction：Basic information about CAS 7511-47-9|p-Benzoquinone, 2,5-bis (1,1,3,3-tetramethylbutyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-Benzoquinone, 2,5-bis (1,1,3,3-tetramethylbutyl)- |
|---|
| CAS Number | 7511-47-9 | Molecular Weight | 332.52000 |
|---|
| Density | 0.959g/cm3 | Boiling Point | 395.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H36O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 148.3ºC |
|---|
Names
| Name | 2,5-bis(2,4,4-trimethylpentan-2-yl)cyclohexa-2,5-diene-1,4-dione |
|---|
Chemical & Physical Properties
| Density | 0.959g/cm3 |
|---|
| Boiling Point | 395.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H36O2 |
|---|
| Molecular Weight | 332.52000 |
|---|
| Flash Point | 148.3ºC |
|---|
| Exact Mass | 332.27200 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 5.91580 |
|---|
| Index of Refraction | 1.491 |
|---|
| InChIKey | RLNQIORMPFHCHW-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)CC(C)(C)C1=CC(=O)C(C(C)(C)CC(C)(C)C)=CC1=O |
|---|
