Introduction:Basic information about CAS 57754-85-5|clopyralid-olamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | clopyralid-olamine |
|---|
| CAS Number | 57754-85-5 | Molecular Weight | 253.08300 |
|---|
| Density | / | Boiling Point | 323.7ºC at 760mmHg |
|---|
| Molecular Formula | C8H10Cl2N2O3 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 100ºC |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | clopyralid-olamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 323.7ºC at 760mmHg |
|---|
| Molecular Formula | C8H10Cl2N2O3 |
|---|
| Molecular Weight | 253.08300 |
|---|
| Flash Point | 100ºC |
|---|
| Exact Mass | 252.00700 |
|---|
| PSA | 96.44000 |
|---|
| LogP | 1.72430 |
|---|
| InChIKey | NQQBTWVFKDDVIB-UHFFFAOYSA-N |
|---|
| SMILES | NCCO.O=C(O)c1nc(Cl)ccc1Cl |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H318 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
|---|
| Risk Phrases | R41;R51/53 |
|---|
| Safety Phrases | S26-S30-S61 |
|---|
| RIDADR | UN 3077 |
|---|
| RTECS | TJ7550700 |
|---|
Synonyms
| (2-hydroxyethyl)ammonium 3,6-dichloropicolinate |
| Clopyralid-olamine [ISO] |
| 3,6-dichloropicolinic acid - 2-aminoethanol (1:1) |
| Clopyralid (2-hydroxyethyl)ammonium |
| 3,6-Dichloropyridine-2-carboxylic acid ethanolammonium salt |
| 3,6-Dichloropyridine-2-carboxylic acid,compound with 2-aminoethanol (1:1) |
| 2-aminoethanol,3,6-dichloropyridine-2-carboxylic acid |
| MFCD00144000 |
| (2-hydroxyethyl)ammonium 3,6-dichloropyridine-2-carboxylate |
| EINECS 216-935-4 |
| EINECS 260-929-4 |
| Clopyralid-olamine |
| 3,6-dichloropyridine-2-carboxylic acid - 2-aminoethanol (1:1) |
| 3,6-dichloropyridine-2-carboxylic acid—2-aminoethan-1-ol |
| 3,6-dichloro-2-pyridinecarboxylic acid compound with 2-aminoethanol (1:1) |