Introduction：Basic information about CAS 7508-99-8|1H-Pyrrole-2,5-dione, 1-(3-fluorophenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Pyrrole-2,5-dione, 1-(3-fluorophenyl)- |
|---|
| CAS Number | 7508-99-8 | Molecular Weight | 191.15900 |
|---|
| Density | 1.421g/cm3 | Boiling Point | 315ºC at 760 mmHg |
|---|
| Molecular Formula | C10H6FNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 144.3ºC |
|---|
Names
| Name | 1-(3-fluorophenyl)pyrrole-2,5-dione |
|---|
Chemical & Physical Properties
| Density | 1.421g/cm3 |
|---|
| Boiling Point | 315ºC at 760 mmHg |
|---|
| Molecular Formula | C10H6FNO2 |
|---|
| Molecular Weight | 191.15900 |
|---|
| Flash Point | 144.3ºC |
|---|
| Exact Mass | 191.03800 |
|---|
| PSA | 37.38000 |
|---|
| LogP | 1.32010 |
|---|
| Index of Refraction | 1.605 |
|---|
| InChIKey | JIOMRSWAMNOWRQ-UHFFFAOYSA-N |
|---|
| SMILES | O=C1C=CC(=O)N1c1cccc(F)c1 |
|---|
Safety Information
