Introduction：Basic information about CAS 5411-53-0|1-bromo-5-methyl-2,4-dinitro-benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-bromo-5-methyl-2,4-dinitro-benzene |
|---|
| CAS Number | 5411-53-0 | Molecular Weight | 261.03000 |
|---|
| Density | 1.793g/cm3 | Boiling Point | 313.1ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5BrN2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 143.1ºC |
|---|
Names
| Name | 1-bromo-5-methyl-2,4-dinitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.793g/cm3 |
|---|
| Boiling Point | 313.1ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5BrN2O4 |
|---|
| Molecular Weight | 261.03000 |
|---|
| Flash Point | 143.1ºC |
|---|
| Exact Mass | 259.94300 |
|---|
| PSA | 91.64000 |
|---|
| LogP | 3.62030 |
|---|
| Index of Refraction | 1.63 |
|---|
| InChIKey | DXYNGFFZOPEJPL-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Br)c([N+](=O)[O-])cc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 5-Brom-2,4-dimethyl-benzolsulfonylchlorid |
| 6-Brom-4-amino-m-xylol |
| 5-bromo-2,4-dimethyl-aniline |
| 5-Brom-2,4-dinitro-toluol |
| 4-Amino-6-bromo-m-xylene |
| 1-bromo-5-methyl-2,4-dinitro-benzene |
| 4-Amino-6-brom-1.3-dimethyl-benzol |
| 5-bromo-2,4-dinitro-toluene |
| 5-Brom-2,4-dimethyl-anilin |
| Benzenamine,5-bromo-2,4-dimethyl |
| 5-bromo-2,4-dimethylphenylamine |
