Introduction:Basic information about CAS 5411-13-2|Benzamide,N-(4-acetylphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzamide,N-(4-acetylphenyl)- |
|---|
| CAS Number | 5411-13-2 | Molecular Weight | 239.26900 |
|---|
| Density | 1.197g/cm3 | Boiling Point | 326.8ºC at 760mmHg |
|---|
| Molecular Formula | C15H13NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 117.4ºC |
|---|
Names
| Name | N-(4-acetylphenyl)benzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.197g/cm3 |
|---|
| Boiling Point | 326.8ºC at 760mmHg |
|---|
| Molecular Formula | C15H13NO2 |
|---|
| Molecular Weight | 239.26900 |
|---|
| Flash Point | 117.4ºC |
|---|
| Exact Mass | 239.09500 |
|---|
| PSA | 46.17000 |
|---|
| LogP | 3.21450 |
|---|
| InChIKey | ZJXQWYZBPKDYLS-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-benzoyl-4-aminoacetophenone |
| 4'-Acetylbenzanilide |
| 4'-benzamidoacetophenone |
| benzoic acid-(4-acetyl-anilide) |
| 4-Benzamino-acetophenon |
| Benzoesaeure-(4-acetyl-anilid) |
| benzamide,n-(4-acetylphenyl) |
| N-(4-ethanoylphenyl)benzamide |