Introduction:Basic information about CAS 5418-07-5|2-AMINO-4,6-DIPHENYL-S-TRIAZINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-AMINO-4,6-DIPHENYL-S-TRIAZINE |
|---|
| CAS Number | 5418-07-5 | Molecular Weight | 248.28300 |
|---|
| Density | 1.229g/cm3 | Boiling Point | 510.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 294.9ºC |
|---|
Names
| Name | 4,6-diphenyl-1,3,5-triazin-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.229g/cm3 |
|---|
| Boiling Point | 510.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12N4 |
|---|
| Molecular Weight | 248.28300 |
|---|
| Flash Point | 294.9ºC |
|---|
| Exact Mass | 248.10600 |
|---|
| PSA | 64.69000 |
|---|
| LogP | 3.36900 |
|---|
| Index of Refraction | 1.653 |
|---|
| InChIKey | HWLRYMYJGAGIME-UHFFFAOYSA-N |
|---|
| SMILES | Nc1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
|---|
Safety Information
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 2-Amino-4,6-diphenyl-1,3,5-triazin |
| 6-Amino-4,6-diphenyl-triazin-(1.3.5) |
| 6-amino-2,4-diphenyl-1,3,5-triazine |
| 2-amino-4,6-diphenyl-1,3,5-triazine |
| 4,6-Diphenyl-[1,3,5]triazin-2-ylamin |
| 2-Amino-4,6-diphenyl-1.3.4-triazin |
| 4,6-diphenyl-[1,3,5]triazin-2-ylamine |