Introduction：Basic information about CAS 68063-18-3|(2E)-2-[(2-nitrophenyl)methylidene]-3H-inden-1-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2E)-2-[(2-nitrophenyl)methylidene]-3H-inden-1-one |
|---|
| CAS Number | 68063-18-3 | Molecular Weight | 265.26300 |
|---|
| Density | 1.362g/cm3 | Boiling Point | 472.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H11NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 234.6ºC |
|---|
Names
| Name | (2E)-2-[(2-nitrophenyl)methylidene]-3H-inden-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.362g/cm3 |
|---|
| Boiling Point | 472.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H11NO3 |
|---|
| Molecular Weight | 265.26300 |
|---|
| Flash Point | 234.6ºC |
|---|
| Exact Mass | 265.07400 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 3.94040 |
|---|
| Index of Refraction | 1.706 |
|---|
| InChIKey | CVCZIDNJPIBPLJ-JLHYYAGUSA-N |
|---|
| SMILES | O=C1C(=Cc2ccccc2[N+](=O)[O-])Cc2ccccc21 |
|---|
Synonyms
| 2-(2-nitro-benzylidene)-indan-1-one |
| 2-(2-Nitro-benzyliden)-indan-1-on |
| 2-(o-Nitrobenzal)indanon |
