Introduction：Basic information about CAS 54100-53-7|dimethyl 2,5-dimethylbenzene-1,4-dicarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dimethyl 2,5-dimethylbenzene-1,4-dicarboxylate |
|---|
| CAS Number | 54100-53-7 | Molecular Weight | 222.23700 |
|---|
| Density | 1.123g/cm3 | Boiling Point | 309.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 150ºC |
|---|
Names
| Name | 2,5-dimethyl-terephthalic acid dimethyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.123g/cm3 |
|---|
| Boiling Point | 309.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14O4 |
|---|
| Molecular Weight | 222.23700 |
|---|
| Flash Point | 150ºC |
|---|
| Exact Mass | 222.08900 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 1.87660 |
|---|
| Index of Refraction | 1.513 |
|---|
| InChIKey | XYQCGGPYZALUAE-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(C)c(C(=O)OC)cc1C |
|---|
Synonyms
| 2,5-Dimethl-terephthalsaeure-dimethylester |
| 2,5-Dimethyl-s-triazolo<1,5-a>pyridin |
| dimethyl 2,5-dimethylterephthalate |
| 2,5-Dimethyl-terephthalsaeure-dimethylester |
