Introduction：Basic information about CAS 14199-83-8|1-deoxy-1-nitro-d-mannitol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-deoxy-1-nitro-d-mannitol |
|---|
| CAS Number | 14199-83-8 | Molecular Weight | 211.17000 |
|---|
| Density | 1.632g/cm3 | Boiling Point | 608.3ºC at 760mmHg |
|---|
| Molecular Formula | C6H13NO7 | Melting Point | 133ºC |
|---|
| MSDS | / | Flash Point | 268.9ºC |
|---|
Names
| Name | 6-nitrohexane-1,2,3,4,5-pentol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.632g/cm3 |
|---|
| Boiling Point | 608.3ºC at 760mmHg |
|---|
| Melting Point | 133ºC |
|---|
| Molecular Formula | C6H13NO7 |
|---|
| Molecular Weight | 211.17000 |
|---|
| Flash Point | 268.9ºC |
|---|
| Exact Mass | 211.06900 |
|---|
| PSA | 146.97000 |
|---|
| Appearance of Characters | Crystalline Powder | White to almost white |
|---|
| Vapour Pressure | 2.45E-17mmHg at 25°C |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | HOFCJTOUEGMYBT-KVTDHHQDSA-N |
|---|
| SMILES | O=[N+]([O-])CC(O)C(O)C(O)C(O)CO |
|---|
Safety Information
| Safety Phrases | 24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2905590090 |
|---|
Customs
| HS Code | 2905590090 |
|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 6-Nitro-D-rhamnit |
| MFCD00024829 |
| 1-nitro-D-1-deoxy-mannitol |
| 1-Desoxy-1-nitro-D-mannitol |
| 1-Nitro-1-deoxy-D-mannitol |
| EINECS 238-051-8 |
| 1-DEOXY-1-NITRO-D-MANNITOL |
| 1-deoxy-1-nitro-D-manno-hexitol |
| 1-Nitro-1-desoxy-D-mannit |
| 6-Nitro-D-manno-hexan-1,2,3,4,5-pentaol |
