Introduction:Basic information about CAS 35888-99-4|3-(4-Biphenylyl)propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(4-Biphenylyl)propanoic acid |
|---|
| CAS Number | 35888-99-4 | Molecular Weight | 226.270 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 400.4±24.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H14O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 297.2±18.0 °C |
|---|
Names
| Name | 3-(4-phenylphenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 400.4±24.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H14O2 |
|---|
| Molecular Weight | 226.270 |
|---|
| Flash Point | 297.2±18.0 °C |
|---|
| Exact Mass | 226.099380 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.60 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | MVFHRQWYCXYYMU-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCc1ccc(-c2ccccc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2(4-Biphenyl)propionic acid |
| 3-(4-Biphenyl)propionic acid |
| Biphenyl-4-propanoic acid |
| 3-(1,1'-biphenyl-4-yl)propanoic acid |
| 3-(4-Biphenylyl)propanoic acid |
| (1,1'-Biphenyl)-4-propanoic acid |
| 3-([1,1'-biphenyl]-4-yl)propionic acid |
| [1,1'-Biphenyl]-4-propanoic acid |
| 3-(4-Biphenyl)propanoic acid |
| 3-(4-biphenylyl)-propanoic acid |
| 3-(Biphenyl-4-yl)propanoic acid |
| 2(para-biphenyl)propionic acid |
| 3-(4-biphenylyl)propionic acid |