Introduction:Basic information about CAS 117049-14-6|BOC-L-Phenylglycinol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | BOC-L-Phenylglycinol |
|---|
| CAS Number | 117049-14-6 | Molecular Weight | 237.295 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 382.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H19NO3 | Melting Point | 136-140ºC |
|---|
| MSDS | USA | Flash Point | 185.0±25.9 °C |
|---|
Names
| Name | (S)-2-(Tert-Butoxycarbonylamino)-2-Phenylethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 382.4±35.0 °C at 760 mmHg |
|---|
| Melting Point | 136-140ºC |
|---|
| Molecular Formula | C13H19NO3 |
|---|
| Molecular Weight | 237.295 |
|---|
| Flash Point | 185.0±25.9 °C |
|---|
| Exact Mass | 237.136490 |
|---|
| PSA | 58.56000 |
|---|
| LogP | 2.24 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.523 |
|---|
| InChIKey | IBDIOGYTZBKRGI-LLVKDONJSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CO)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | C |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (S)-tert-Butyl (2-hydroxy-1-phenylethyl)carbamate |
| N-Boc-L-phenylglycinol |
| MFCD00274206 |
| N-(tert-Butoxycarbonyl)-L-2-phenylglycinol |
| tert-Butyl [(1S)-2-hydroxy-1-phenylethyl]carbamate |
| BOC-L-Phenylglycinol |
| (S)-2-(tert-Butoxycarbonylamino)-2-phenylethanol |
| tert-butyl N-[(1S)-2-hydroxy-1-phenylethyl]carbamate |
| N-Boc-L-2-phenylglycinol |
| 2-Methyl-2-propanyl [(1S)-2-hydroxy-1-phenylethyl]carbamate |
| Carbamic acid, N-[(1S)-2-hydroxy-1-phenylethyl]-, 1,1-dimethylethyl ester |
| Boc-phenylglycinol |