Introduction:Basic information about CAS 21691-44-1|ZL-Nva-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ZL-Nva-OH |
|---|
| CAS Number | 21691-44-1 | Molecular Weight | 251.278 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 439.4±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H17NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 219.6±26.8 °C |
|---|
Names
| Name | (2S)-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 439.4±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H17NO4 |
|---|
| Molecular Weight | 251.278 |
|---|
| Flash Point | 219.6±26.8 °C |
|---|
| Exact Mass | 251.115753 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 2.78 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.533 |
|---|
| InChIKey | NSJDRLWFFAWSFP-NSHDSACASA-N |
|---|
| SMILES | CCCC(NC(=O)OCc1ccccc1)C(=O)O |
|---|
| Storage condition | Store at RT. |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-benzyloxycarbonyl-norvaline |
| DL-Norvaline, N-[(phenylmethoxy)carbonyl]- |
| 2S-2-benzyloxycarbonylamino-2-propyl-acetic acid |
| N-[(Benzyloxy)carbonyl]-L-norvaline |
| MFCD00063167 |
| CBZ-L-Norvaline |
| N-benzyloxycarbonyl-L-norvaline |
| Z-Nva-OH |
| L-Norvaline, N-[(phenylmethoxy)carbonyl]- |
| Z-DL-Nva-OH |
| N-[(Benzyloxy)carbonyl]norvaline |
| Z-L-norvaline |
| N-Cbz-DL-norvaline |
| Z-CBZ-L-NORVALINE |
| Norvaline, N-[(phenylmethoxy)carbonyl]- |
| (2S)-2-{[(Benzyloxy)carbonyl]amino}pentanoic acid |
| Benzyloxycarbonyl-L-norvaline |