Introduction：Basic information about CAS 111047-53-1|(r)-phenyl-(toluene-4-sulfonylamino)-acetic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (r)-phenyl-(toluene-4-sulfonylamino)-acetic acid methyl ester |
|---|
| CAS Number | 111047-53-1 | Molecular Weight | 319.37500 |
|---|
| Density | 1.256g/cm3 | Boiling Point | 473.5ºC at 760mmHg |
|---|
| Molecular Formula | C16H17NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 240.1ºC |
|---|
Names
| Name | (r)-phenyl-(toluene-4-sulfonylamino)-acetic acid methyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.256g/cm3 |
|---|
| Boiling Point | 473.5ºC at 760mmHg |
|---|
| Molecular Formula | C16H17NO4S |
|---|
| Molecular Weight | 319.37500 |
|---|
| Flash Point | 240.1ºC |
|---|
| Exact Mass | 319.08800 |
|---|
| PSA | 80.85000 |
|---|
| LogP | 3.65930 |
|---|
| Vapour Pressure | 3.92E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | RUYIDMOVZKCDIJ-OAHLLOKOSA-N |
|---|
| SMILES | COC(=O)C(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
|---|
Synonyms
| methyl N-p-toluenesulfonyl-1-phenylglycinate |
| methyl N-p-tolylsulfonyl-2-phenylglycinate |
| N-Ts-phenylglycine methyl ester |
