Introduction：Basic information about CAS 112525-72-1|Boc-L-Trp, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-L-Trp |
|---|
| CAS Number | 112525-72-1 | Molecular Weight | 304.341 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 535.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H20N2O4 | Melting Point | 131 °C(dec.) |
|---|
| MSDS | / | Flash Point | 277.8±28.7 °C |
|---|
Names
| Name | 3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 535.7±45.0 °C at 760 mmHg |
|---|
| Melting Point | 131 °C(dec.) |
|---|
| Molecular Formula | C16H20N2O4 |
|---|
| Molecular Weight | 304.341 |
|---|
| Flash Point | 277.8±28.7 °C |
|---|
| Exact Mass | 304.142303 |
|---|
| PSA | 91.42000 |
|---|
| LogP | 2.89 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | NFVNYBJCJGKVQK-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
|---|
Synonyms
| tert-Butoxycarbonyl-L-tryptophan |
| N-(tert-Butoxycarbonyl)-L-tryptophan |
| Boc-L-Trp |
| N-tert-butoxycarbonyl-protected tryptophan |
| t-butoxycarbonyltryptophan |
| Boc-D-Trp-OH |
| Boc-DL-tryptophan |
| N-tert-Butoxycarbonyltryptophan |
| N-tert-Butoxycarbonyl-L-tryptophan |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-tryptophan |
| tert-Butoxycarbonyltryptophan |
| N-tert-Butyloxycarbonyl-L-tryptophan |
| Na-(tert-Butoxycarbonyl)-L-tryptophan |
| L-Tryptophan, N-[(1,1-dimethylethoxy)carbonyl]- |
| Nalpha-Boc-L-Tryptophane |
| D,L-N-t-Boc-tryptophan |
| Nalpha-Boc-D-Tryptophane |
| Boc-DL-Trp-OH |
