Introduction：Basic information about CAS 67525-74-0|Calcium bis(2,3-dihydroxypropanoate), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Calcium bis(2,3-dihydroxypropanoate) |
|---|
| CAS Number | 67525-74-0 | Molecular Weight | 250.217 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C6H10CaO8 | Melting Point | 134ºC (dec.)(lit.) |
|---|
| MSDS | Chinese | Flash Point | / |
|---|
Names
| Name | Calcium 2,3-Dihydroxypropionate Hydrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 134ºC (dec.)(lit.) |
|---|
| Molecular Formula | C6H10CaO8 |
|---|
| Molecular Weight | 250.217 |
|---|
| Exact Mass | 250.000153 |
|---|
| PSA | 133.52000 |
|---|
| InChIKey | VPWAVWZPVGDNMN-UHFFFAOYSA-L |
|---|
| SMILES | O=C([O-])C(O)CO.O=C([O-])C(O)CO.[Ca+2] |
|---|
| Water Solubility | Soluble in cold and hot water. |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Safety Phrases | S22;S24/25 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Calcium bis(2,3-dihydroxypropanoate) |
| MFCD00149289 |
| Propanoic acid, 2,3-dihydroxy-, calcium salt (2:1) |
| dl-glyceric acid hemicalcium salt hydrate |
| EINECS 282-247-6 |
