Introduction：Basic information about CAS 675602-71-8|(S)-1-PHENYL-2-PROPEN-1-OL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-1-PHENYL-2-PROPEN-1-OL |
|---|
| CAS Number | 675602-71-8 | Molecular Weight | 368.46900 |
|---|
| Density | 1.172g/cm3 | Boiling Point | 534ºC at 760 mmHg |
|---|
| Molecular Formula | C22H28N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 276.7ºC |
|---|
Names
| Name | benzyl N-[(2S)-1-(4-hydroxyphenyl)-3-pyrrolidin-1-ylpropan-2-yl]-N-methylcarbamate |
|---|
Chemical & Physical Properties
| Density | 1.172g/cm3 |
|---|
| Boiling Point | 534ºC at 760 mmHg |
|---|
| Molecular Formula | C22H28N2O3 |
|---|
| Molecular Weight | 368.46900 |
|---|
| Flash Point | 276.7ºC |
|---|
| Exact Mass | 368.21000 |
|---|
| PSA | 53.01000 |
|---|
| LogP | 3.60560 |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | AIGXWIJHPRPNMP-FQEVSTJZSA-N |
|---|
| SMILES | CN(C(=O)OCc1ccccc1)C(Cc1ccc(O)cc1)CN1CCCC1 |
|---|
