Introduction：Basic information about CAS 876461-55-1|1-Cbz-3-Amino-piperidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Cbz-3-Amino-piperidine |
|---|
| CAS Number | 876461-55-1 | Molecular Weight | 234.294 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 367.2±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H18N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 175.9±27.9 °C |
|---|
Names
| Name | (S)-Benzyl 3-aminopiperidine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 367.2±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H18N2O2 |
|---|
| Molecular Weight | 234.294 |
|---|
| Flash Point | 175.9±27.9 °C |
|---|
| Exact Mass | 234.136826 |
|---|
| PSA | 55.56000 |
|---|
| LogP | 1.33 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | PBFBPDLWODIXHK-LBPRGKRZSA-N |
|---|
| SMILES | NC1CCCN(C(=O)OCc2ccccc2)C1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Synonyms
| DL-3-Amino-1-N-Cbz-piperidine |
| Benzyl 3-amino-1-piperidinecarboxylate |
| (S)-1-Cbz-3-aminopiperidine |
| Benzyl (3S)-3-aminopiperidine-1-carboxylate |
| 1-Cbz-3-Amino-piperidine |
| 1-Piperidinecarboxylic acid, 3-amino-, phenylmethyl ester |
| Benzyl (3S)-3-amino-1-piperidinecarboxylate |
| benzyl 3-aminopiperidine-1-carboxylate |
| 1-Piperidinecarboxylic acid, 3-amino-, phenylmethyl ester, (3S)- |
