Introduction：Basic information about CAS 87713-13-1|N-(tert-Butoxycarbonyl)-L-phenylalanine-15N, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(tert-Butoxycarbonyl)-L-phenylalanine-15N |
|---|
| CAS Number | 87713-13-1 | Molecular Weight | 266.29800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H19NO4 | Melting Point | 85-87ºC(lit.) |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | N-(tert-Butoxycarbonyl)-L-phenylalanine-15N |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 85-87ºC(lit.) |
|---|
| Molecular Formula | C14H19NO4 |
|---|
| Molecular Weight | 266.29800 |
|---|
| Exact Mass | 266.12800 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 2.59790 |
|---|
| InChIKey | ZYJPUMXJBDHSIF-ATIMDCQMSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)O |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Boc-Phe-OH-15N |
| L-Phenylalanine-15N,N-t-Boc derivative |
| MFCD00084236 |
