Introduction:Basic information about CAS 30418-38-3|(1S)-1-(3,4,5-Trimethoxybenzyl)-1,2,3,4-tetrahydro-6,7-isoquinoli nediol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1S)-1-(3,4,5-Trimethoxybenzyl)-1,2,3,4-tetrahydro-6,7-isoquinoli nediol |
|---|
| CAS Number | 30418-38-3 | Molecular Weight | 345.39000 |
|---|
| Density | 1.235g/cm3 | Boiling Point | 533.3ºC at 760mmHg |
|---|
| Molecular Formula | C19H23NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 276.3ºC |
|---|
Names
| Name | (1S)-1-(3,4,5-Trimethoxybenzyl)-1,2,3,4-tetrahydro-6,7-isoquinoli nediol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.235g/cm3 |
|---|
| Boiling Point | 533.3ºC at 760mmHg |
|---|
| Molecular Formula | C19H23NO5 |
|---|
| Molecular Weight | 345.39000 |
|---|
| Flash Point | 276.3ºC |
|---|
| Exact Mass | 345.15800 |
|---|
| PSA | 80.18000 |
|---|
| LogP | 2.88190 |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | RGVPOXRFEPSFGH-AWEZNQCLSA-N |
|---|
| SMILES | COc1cc(CC2NCCc3cc(O)c(O)cc32)cc(OC)c1OC |
|---|
Synonyms
| D-Timolol maleate |
| (S,S)-cyclopentyl 1,3-dicarboxylic acid |
| (-)-Trimetoquinol |
| (S)-1-(tert-butylamino)-3-[(4-morpholino-1,2,5-thiadiazol-3-yl)oxy]-2-propanol hemimaleate |
| (S)-trans-Cyclopentan-1,3-dicarbonsaeure |
| timolol,maleate (2:1) |
| (S)-(-)-1-(3,4,5-trimethoxybenzyl)-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline |
| (S)-trans-cyclopentane-1,3-dicarboxylic acid |
| (S)-1-(tert-butylamino)-3-[(4-morpholino-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol hemimaleate |
| (S)-(-)-trimetoquinol |
| (S)-timolol hemimaleate |
| (S)-thymolol hemimaleate |
| (S)-tretoquinol |
| (S)-1-tert-butylamino-3-(4-morpholin-4-yl-[1,2,5]thiadiazol-3-yloxy)-propan-2-ol,maleate (2:1) |