Introduction：Basic information about CAS 19616-28-5|N-(2,4-Dimethylphenyl)-2,4-dimethylaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(2,4-Dimethylphenyl)-2,4-dimethylaniline |
|---|
| CAS Number | 19616-28-5 | Molecular Weight | 225.329 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 350.9±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H19N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 172.3±14.7 °C |
|---|
Names
| Name | N-(2,4-Dimethylphenyl)-2,4-dimethylaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 350.9±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H19N |
|---|
| Molecular Weight | 225.329 |
|---|
| Flash Point | 172.3±14.7 °C |
|---|
| Exact Mass | 225.151749 |
|---|
| PSA | 12.03000 |
|---|
| LogP | 4.81 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | MAINCNYZMOMWRA-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(Nc2ccc(C)cc2C)c(C)c1 |
|---|
Synonyms
| N-(2,4-dimethylphenyl)-2,4-dimethylphenylamine |
| 2.4.2'.4'-Tetramethyl-diphenylamin |
| N-(2,4-Dimethylphenyl)-2,4-dimethylaniline |
| Benzenamine, N-(2,4-dimethylphenyl)-2,4-dimethyl- |
| bis(2,4-dimethylphenyl)amine |
| di(2,4-dimethylphenyl)amine |
| dixylylamine |
| X4112 |
| Bis-(2,4-dimethyl-phenyl)-amin |
| N-(2,4-DIMETHYLPHENYL)-2,4-DIMETHYLBENZENAMINE |
