Introduction:Basic information about CAS 141645-23-0|(2-Butyl-5-nitro-3-benzofuranyl)[4-[3-(dibutylamino)propoxy]phenyl]methanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2-Butyl-5-nitro-3-benzofuranyl)[4-[3-(dibutylamino)propoxy]phenyl]methanone |
|---|
| CAS Number | 141645-23-0 | Molecular Weight | 508.649 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 638.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H40N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 339.7±31.5 °C |
|---|
Names
| Name | (2-butyl-5-nitro-1-benzofuran-3-yl)-[4-[3-(dibutylamino)propoxy]phenyl]methanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 638.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H40N2O5 |
|---|
| Molecular Weight | 508.649 |
|---|
| Flash Point | 339.7±31.5 °C |
|---|
| Exact Mass | 508.293732 |
|---|
| PSA | 88.50000 |
|---|
| LogP | 8.58 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.560 |
|---|
| InChIKey | YIYARJKYRBMMJG-UHFFFAOYSA-N |
|---|
| SMILES | CCCCc1oc2ccc([N+](=O)[O-])cc2c1C(=O)c1ccc(OCCCN(CCCC)CCCC)cc1 |
|---|
Synonyms
| T56 BOJ C4 DVR DO3N4&4& GNW |
| (2-n-butyl-5-nitro-1-benzofuran-3-yl)[[4-(di-n-butylamino)propoxy]-phenyl] methanone |
| (2-Butyl-5-nitro-1-benzofuran-3-yl){4-[3-(dibutylamino)propoxy]phenyl}methanone |
| (2-Butyl-5-nitro-3-benzofuranyl)[4-[3-(dibutylamino)propoxy]phenyl]methanone |
| 2-n-butyl-3-(4-[3-(dibutylamino)-propoxy]-benzoyl)-5-nitrobenzofuran |
| (2-butyl-5-nitrobenzofuran-3-yl)(4-(3-(dibutylamino)propoxy)phenyl)methanone |
| 2-n-butyl-3-{4-[3-(di-n-butylamino)propoxy]benzoyl}-5-nitrobenzofuran |
| MET056 |
| Methanone, (2-butyl-5-nitro-3-benzofuranyl)[4-[3-(dibutylamino)propoxy]phenyl]- |
| Dronedarone Impurity 5 |