Introduction：Basic information about CAS 85373-96-2|3-Bromo-4-(trifluoromethoxy)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Bromo-4-(trifluoromethoxy)benzoic acid |
|---|
| CAS Number | 85373-96-2 | Molecular Weight | 285.015 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | 279.6±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H4BrF3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 122.9±27.3 °C |
|---|
Names
| Name | 3-Bromo-4-(trifluoromethoxy)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Boiling Point | 279.6±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H4BrF3O3 |
|---|
| Molecular Weight | 285.015 |
|---|
| Flash Point | 122.9±27.3 °C |
|---|
| Exact Mass | 283.929596 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 3.61 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.518 |
|---|
| InChIKey | FZZJKGGHTKIIIJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(OC(F)(F)F)c(Br)c1 |
|---|
Synonyms
| Benzoic acid, 3-bromo-4-(trifluoromethoxy)- |
| 3-bromo-4-trifluoromethoxybenzoic acid |
| 3-Bromo-4-(trifluoromethoxy)benzoic acid |
