Introduction：Basic information about CAS 1146080-16-1|4-[2-(3-Chloro-phenyl)-2-hydroxy-ethyl]-piperazine-1-carboxylic acid tert-bu, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[2-(3-Chloro-phenyl)-2-hydroxy-ethyl]-piperazine-1-carboxylic acid tert-butyl ester |
|---|
| CAS Number | 1146080-16-1 | Molecular Weight | 340.84500 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 452.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H25ClN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 227.6±28.7 °C |
|---|
Names
| Name | tert-butyl 4-[2-(3-chlorophenyl)-2-hydroxyethyl]piperazine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 452.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H25ClN2O3 |
|---|
| Molecular Weight | 340.84500 |
|---|
| Flash Point | 227.6±28.7 °C |
|---|
| Exact Mass | 340.15500 |
|---|
| PSA | 53.01000 |
|---|
| LogP | 2.80190 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | RPTAFFVANGYTGC-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(O)c2cccc(Cl)c2)CC1 |
|---|
Synonyms
| tert-butyl 4-[2-(3-chlorophenyl)-2-hydroxyethyl]piperazinecarboxylate |
| tert-Butyl 4-(2-(3-chlorophenyl)-2-hydroxyethyl)piperazine-1-carboxylate |
| 4-[2-(3-Chloro-phenyl)-2-hydroxy-ethyl]-piperazine-1-carboxylic acid tert-butyl ester |
| MFCD11215283 |
