Introduction：Basic information about CAS 40707-01-5|5-Chloro-1-methyl-1H-benzo[d][1,3]oxazine-2,4-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Chloro-1-methyl-1H-benzo[d][1,3]oxazine-2,4-dione |
|---|
| CAS Number | 40707-01-5 | Molecular Weight | 211.60200 |
|---|
| Density | 1.476 g/cm3 | Boiling Point | 344.8ºC at 760 mmHg |
|---|
| Molecular Formula | C9H6ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 162.3ºC |
|---|
Names
| Name | 5-chloro-1-methyl-3,1-benzoxazine-2,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.476 g/cm3 |
|---|
| Boiling Point | 344.8ºC at 760 mmHg |
|---|
| Molecular Formula | C9H6ClNO3 |
|---|
| Molecular Weight | 211.60200 |
|---|
| Flash Point | 162.3ºC |
|---|
| Exact Mass | 211.00400 |
|---|
| PSA | 52.21000 |
|---|
| LogP | 1.14510 |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | BTNWNXWHFWYONH-UHFFFAOYSA-N |
|---|
| SMILES | Cn1c(=O)oc(=O)c2c(Cl)cccc21 |
|---|
Synonyms
| 5-Chloro-N-methylisatoic anhydride |
| AC-1746 |
| 5-chloro-1-methyl-3,1-benzoxazine-2,4(1H)-dione |
| 5-Chloro-1-methyl-1H |
| 6-chloro-N-methylisatoic anhydride |
| N-methyl-5-chloroisatoic anhydride |
| 5-chloro-1-methyl-1H-benzo[d][1,3]oxazine-2,4-dione |
| 5-Chloro-N-methylisatoic anhydrazide |
| benzo[d][1,3]oxazine-2,4-dione |
