Introduction：Basic information about CAS 20829-96-3|6-Chloro-isatoic anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Chloro-isatoic anhydride |
|---|
| CAS Number | 20829-96-3 | Molecular Weight | 197.575 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H4ClNO3 | Melting Point | 272.5-272.9°C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-chloro-1H-3,1-benzoxazine-2,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Melting Point | 272.5-272.9°C |
|---|
| Molecular Formula | C8H4ClNO3 |
|---|
| Molecular Weight | 197.575 |
|---|
| Exact Mass | 196.987976 |
|---|
| PSA | 63.33000 |
|---|
| LogP | 1.50 |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | NIGOFAVNIBBNJV-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]c2cccc(Cl)c2c(=O)o1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-Chloro-1H-benzo[d][1,3]oxazine-2,; 4-dione |
| 5-chloro isotoic anhydride |
| 5-chlorobenzo[d][1,3]oxazine-2,4-dione |
| 6-Chloro-isatoic anhydride |
| 5-chloroisatoic anhydride |
| 6-chloroisatoic anhydride |
| 5-chloro-1H-benzo[d][1,3]oxazine-2,4-dione |
| 2H-3,1-benzoxazine-2,4(1H)-dione,5-chloro |
| 3-chloroisatoic anhydride |
| 2H-3,1-Benzoxazine-2,4(1H)-dione, 5-chloro- |
| 5-Chloro-2H-3,1-benzoxazine-2,4(1H)-dione |
