Introduction:Basic information about CAS 125115-01-7|(3-Bromobenzyl)malonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3-Bromobenzyl)malonic acid |
|---|
| CAS Number | 125115-01-7 | Molecular Weight | 273.08000 |
|---|
| Density | / | Boiling Point | 436ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9BrO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 217.5ºC |
|---|
Names
| Name | (3-Bromobenzyl)malonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 436ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9BrO4 |
|---|
| Molecular Weight | 273.08000 |
|---|
| Flash Point | 217.5ºC |
|---|
| Exact Mass | 271.96800 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 1.77700 |
|---|
| Vapour Pressure | 2.26E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | FZVVUIMOKVDMNK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(Cc1cccc(Br)c1)C(=O)O |
|---|
Synonyms
| m-bromobenzylmalonic acid |
| 2H-1-Benzopyran-4-acetic acid,3-bromo-7-methoxy-2-oxo |
| 3-bromo-7-methoxycoumarin-4-acetic acid |