Introduction:Basic information about CAS 854644-24-9|1-benzyl-3-(biphenyl-4-yl)thiourea, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-benzyl-3-(biphenyl-4-yl)thiourea |
|---|
| CAS Number | 854644-24-9 | Molecular Weight | 318.43500 |
|---|
| Density | 1.201g/cm3 | Boiling Point | 480.98ºC at 760 mmHg |
|---|
| Molecular Formula | C20H18N2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 244.688ºC |
|---|
Names
| Name | 1-Benzyl-3-(4-biphenylyl)thioure |
|---|
Chemical & Physical Properties
| Density | 1.201g/cm3 |
|---|
| Boiling Point | 480.98ºC at 760 mmHg |
|---|
| Molecular Formula | C20H18N2S |
|---|
| Molecular Weight | 318.43500 |
|---|
| Flash Point | 244.688ºC |
|---|
| Exact Mass | 318.11900 |
|---|
| PSA | 63.19000 |
|---|
| LogP | 5.32450 |
|---|
| Index of Refraction | 1.682 |
|---|
| InChIKey | RJOCGEVAWLDEMY-UHFFFAOYSA-N |
|---|
| SMILES | S=C(NCc1ccccc1)Nc1ccc(-c2ccccc2)cc1 |
|---|