Introduction:Basic information about CAS 67643-41-8|6-Bromo-4-hydroxy-8-methyl-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Bromo-4-hydroxy-8-methyl-3-quinolinecarbonitrile |
|---|
| CAS Number | 67643-41-8 | Molecular Weight | 263.09000 |
|---|
| Density | 1.71g/cm3 | Boiling Point | 450.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7BrN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.4ºC |
|---|
Names
| Name | 6-Bromo-4-hydroxy-8-methyl-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.71g/cm3 |
|---|
| Boiling Point | 450.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7BrN2O |
|---|
| Molecular Weight | 263.09000 |
|---|
| Flash Point | 226.4ºC |
|---|
| Exact Mass | 261.97400 |
|---|
| PSA | 56.65000 |
|---|
| LogP | 2.47068 |
|---|
| Index of Refraction | 1.719 |
|---|
| InChIKey | OZUKMNIJUXVVKR-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Br)cc2c(=O)c(C#N)c[nH]c12 |
|---|