Introduction：Basic information about CAS 83482-77-3|Vinmegallate-d9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Vinmegallate-d9 |
|---|
| CAS Number | 83482-77-3 | Molecular Weight | 500.58500 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 543.5ºC at 760 mmHg |
|---|
| Molecular Formula | C30H32N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 282.5ºC |
|---|
Names
| Name | (3α,16α)-17,18-Didehydroeburnamenin-14-ylmethyl 3,4,5-trimethoxyb enzoate |
|---|
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 543.5ºC at 760 mmHg |
|---|
| Molecular Formula | C30H32N2O5 |
|---|
| Molecular Weight | 500.58500 |
|---|
| Flash Point | 282.5ºC |
|---|
| Exact Mass | 500.23100 |
|---|
| PSA | 62.16000 |
|---|
| LogP | 5.18190 |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | YBXKKOCGWBHEBM-DGPALRBDSA-N |
|---|
| SMILES | CCC12C=CCN3CCc4c(n(c5ccccc45)C(COC(=O)c4cc(OC)c(OC)c(OC)c4)=C1)C32 |
|---|
