Introduction:Basic information about CAS 1214342-70-7|5-Chloro-3-(trifluoromethyl)pyridin-2-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Chloro-3-(trifluoromethyl)pyridin-2-ol |
|---|
| CAS Number | 1214342-70-7 | Molecular Weight | 197.542 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 260.8±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3ClF3NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 111.5±25.9 °C |
|---|
Names
| Name | 5-Chloro-3-(trifluoromethyl)pyridin-2-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 260.8±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3ClF3NO |
|---|
| Molecular Weight | 197.542 |
|---|
| Flash Point | 111.5±25.9 °C |
|---|
| Exact Mass | 196.985519 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 2.33 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.482 |
|---|
| InChIKey | ZHDJWTAHGYSQQV-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]cc(Cl)cc1C(F)(F)F |
|---|
Synonyms
| 5-chloro-3-(trifluoromethyl)-1H-pyridin-2-one |
| 2-pyridinol, 5-chloro-3-(trifluoromethyl)- |
| 5-Chloro-3-(trifluoromethyl)-2-pyridinol |
| 5-Chloro-3-(trifluoromethyl)pyridin-2-ol |