Introduction:Basic information about CAS 30989-05-0|tris[2-[2-(2-methoxyethoxy)ethoxy]ethyl] orthoborate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tris[2-[2-(2-methoxyethoxy)ethoxy]ethyl] orthoborate |
|---|
| CAS Number | 30989-05-0 | Molecular Weight | 500.38600 |
|---|
| Density | 1.056g/cm3 | Boiling Point | 493.3ºC at 760 mmHg |
|---|
| Molecular Formula | C21H45BO12 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 252.1ºC |
|---|
Names
| Name | tris[2-[2-(2-methoxyethoxy)ethoxy]ethyl] borate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.056g/cm3 |
|---|
| Boiling Point | 493.3ºC at 760 mmHg |
|---|
| Molecular Formula | C21H45BO12 |
|---|
| Molecular Weight | 500.38600 |
|---|
| Flash Point | 252.1ºC |
|---|
| Exact Mass | 500.30000 |
|---|
| PSA | 110.76000 |
|---|
| LogP | 0.05990 |
|---|
| Index of Refraction | 1.435 |
|---|
| InChIKey | BYRJZJXBVKUYFH-UHFFFAOYSA-N |
|---|
| SMILES | COCCOCCOCCOB(OCCOCCOCCOC)OCCOCCOCCOC |
|---|
Safety Information
Customs
| HS Code | 2920909090 |
|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Trimethoxytriglycol orthoborate |
| EINECS 250-418-4 |
| Triethylene glycol monomethyl ether borate (3:1) |
| Tris(2-(2-(2-methoxyethoxy)ethoxy)ethyl) orthoborate |
| tris(methoxyethoxyethoxyethyl) borate |
| Ethanol,2-[2-(2-methoxyethoxy)ethoxy]-,triester with boric acid (H3BO3) (8CI,9CI) |
| tris(2-(2-(2-methoxyethoxy)ethoxy)ethyl)borate |
| tris(1,4,7,10-tetraoxaundecane)borate |
| Triethylene glycol monomethylether orthoborate |
| Ethanol,2-[2-(2-methoxyethoxy)ethoxy]-,1,1',1''-triester with boric acid (H3BO3) |