Introduction：Basic information about CAS 3807-81-6|5-Nitrobenzene-1,2,3-tricarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Nitrobenzene-1,2,3-tricarboxylic acid |
|---|
| CAS Number | 3807-81-6 | Molecular Weight | 255.138 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | 546.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H5NO8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 240.4±18.6 °C |
|---|
Names
| Name | 5-nitrobenzene-1,2,3-tricarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Boiling Point | 546.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H5NO8 |
|---|
| Molecular Weight | 255.138 |
|---|
| Flash Point | 240.4±18.6 °C |
|---|
| Exact Mass | 255.001511 |
|---|
| PSA | 157.72000 |
|---|
| LogP | 0.21 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.699 |
|---|
| InChIKey | KIRNHRJGEAFKPM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc(C(=O)O)c1C(=O)O |
|---|
Safety Information
Synonyms
| MFCD03839939 |
| 5-Nitro-benzol-1,2,3-tricarbonsaeure |
| 1-Nitrobenzene-3,4,5-tricarboxylic acid |
| 1,2,3-Benzenetricarboxylic acid, 5-nitro- |
| 5-nitro-1,2,3-benzenetricarboxylate |
| 5-Nitro-1,2,3-benzenetricarboxylic acid |
| 5-nitro-benzene-1,2,3-tricarboxylic acid |
| 5-nitrobenzene-1,2,3-tricarboxylic acid |
