Introduction：Basic information about CAS 19602-82-5|2-[(2-carbonochloridoylphenyl)disulfanyl]benzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(2-carbonochloridoylphenyl)disulfanyl]benzoyl chloride |
|---|
| CAS Number | 19602-82-5 | Molecular Weight | 343.24800 |
|---|
| Density | 1.51g/cm3 | Boiling Point | 443.7ºC at 760mmHg |
|---|
| Molecular Formula | C14H8Cl2O2S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.1ºC |
|---|
Names
| Name | 2-[(2-carbonochloridoylphenyl)disulfanyl]benzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.51g/cm3 |
|---|
| Boiling Point | 443.7ºC at 760mmHg |
|---|
| Molecular Formula | C14H8Cl2O2S2 |
|---|
| Molecular Weight | 343.24800 |
|---|
| Flash Point | 222.1ºC |
|---|
| Exact Mass | 341.93400 |
|---|
| PSA | 84.74000 |
|---|
| LogP | 5.24400 |
|---|
| Vapour Pressure | 4.54E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.687 |
|---|
| InChIKey | DSFZYLCRXIWFFW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1ccccc1SSc1ccccc1C(=O)Cl |
|---|
Safety Information
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2,2'-dithiobisbenzoic acid dichloride |
| benzoyl chloride,2,2'-dithiobis |
| 2,2'-dithiodibenzoyl chloride |
| 2,2'-dithiodibenzoic acid dichloride |
| 2,2'-dithiobenzoyl chloride |
| 2,2'-DIMETHOXYBIPHENYL |
| EINECS 243-180-8 |
| dithio-2,2'-bisbenzoic acid dichloride |
