Introduction：Basic information about CAS 84386-11-8|Baxitozine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Baxitozine |
|---|
| CAS Number | 84386-11-8 | Molecular Weight | 266.24700 |
|---|
| Density | 1.242g/cm3 | Boiling Point | 457.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.3ºC |
|---|
Names
| Name | (E)-4-oxo-4-(3,4,5-trimethoxyphenyl)but-2-enoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.242g/cm3 |
|---|
| Boiling Point | 457.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14O6 |
|---|
| Molecular Weight | 266.24700 |
|---|
| Flash Point | 174.3ºC |
|---|
| Exact Mass | 266.07900 |
|---|
| PSA | 82.06000 |
|---|
| LogP | 1.53590 |
|---|
| Index of Refraction | 1.539 |
|---|
| InChIKey | PVCWLTQMJSUKGZ-SNAWJCMRSA-N |
|---|
| SMILES | COc1cc(C(=O)C=CC(=O)O)cc(OC)c1OC |
|---|
Synonyms
| Baxitozina |
| Baxitozine |
| Baxitozine [INN] |
| Baxitozina [INN-Spanish] |
| 4-oxo-4-(3,4,5-trimethoxyphenyl)butenoic acid |
| (E)-4-(3,4,5-Trimethoxyphenyl)-4-oxo-2-butenoic acid |
| 2-Butenoic acid,4-oxo-4-(3,4,5-trimethoxyphenyl)-,(E) |
| Baxitozinum |
| (E)-4-Oxo-4-(3,4,5-trimethoxyphenyl)-2-butenoic acid |
| 3-(3,4,5-trimethoxybenzoyl)acrylic acid |
| (E)-4-oxo-4-(trimethoxyphenyl)but-2-enoic acid |
| Baxitozinum [INN-Latin] |
