Introduction：Basic information about CAS 7541-30-2|Mesuprine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Mesuprine |
|---|
| CAS Number | 7541-30-2 | Molecular Weight | 394.48500 |
|---|
| Density | 1.302g/cm3 | Boiling Point | 600.7ºC at 760 mmHg |
|---|
| Molecular Formula | C19H26N2O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 317.1ºC |
|---|
Names
| Name | N-[2-Hydroxy-5-(1-hydroxy-2-{[2-(4-methoxyphenyl)ethyl]amino}prop yl)phenyl]methanesulfonamide |
|---|
Chemical & Physical Properties
| Density | 1.302g/cm3 |
|---|
| Boiling Point | 600.7ºC at 760 mmHg |
|---|
| Molecular Formula | C19H26N2O5S |
|---|
| Molecular Weight | 394.48500 |
|---|
| Flash Point | 317.1ºC |
|---|
| Exact Mass | 394.15600 |
|---|
| PSA | 116.27000 |
|---|
| LogP | 3.57120 |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | REDZESHOHKCYCT-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(CCNC(C)C(O)c2ccc(O)c(NS(C)(=O)=O)c2)cc1 |
|---|
