Introduction：Basic information about CAS 80680-05-3|Tivanidazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tivanidazole |
|---|
| CAS Number | 80680-05-3 | Molecular Weight | 279.31800 |
|---|
| Density | 1.43g/cm3 | Boiling Point | 487.1ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13N5O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 248.4ºC |
|---|
Names
| Name | 2-ethyl-5-[(E)-1-(1-methyl-5-nitroimidazol-2-yl)prop-1-en-2-yl]-1,3,4-thiadiazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Boiling Point | 487.1ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13N5O2S |
|---|
| Molecular Weight | 279.31800 |
|---|
| Flash Point | 248.4ºC |
|---|
| Exact Mass | 279.07900 |
|---|
| PSA | 117.66000 |
|---|
| LogP | 2.82590 |
|---|
| Index of Refraction | 1.686 |
|---|
| InChIKey | FAMHRHPGWNQVGW-FNORWQNLSA-N |
|---|
| SMILES | CCc1nnc(C(C)=Cc2ncc([N+](=O)[O-])n2C)s1 |
|---|
Synonyms
| Tivanidazole |
| Tivanidazole [INN] |
| UNII-7E136TJT00 |
| (E)-2-Ethyl-5-(1-methyl-2-(1-methyl-5-nitroimidazol-2-yl)vinyl)-1,3,4-thiadiazole |
