Introduction：Basic information about CAS 21365-49-1|tralonide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tralonide |
|---|
| CAS Number | 21365-49-1 | Molecular Weight | 489.38000 |
|---|
| Density | 1.36g/cm3 | Boiling Point | 573.2ºC at 760mmHg |
|---|
| Molecular Formula | C24H28Cl2F2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 194ºC |
|---|
Names
| Name | tralonide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.36g/cm3 |
|---|
| Boiling Point | 573.2ºC at 760mmHg |
|---|
| Molecular Formula | C24H28Cl2F2O4 |
|---|
| Molecular Weight | 489.38000 |
|---|
| Flash Point | 194ºC |
|---|
| Exact Mass | 488.13300 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 4.85980 |
|---|
| Vapour Pressure | 3.81E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.561 |
|---|
| InChIKey | OGZHZYVCWDUIJV-VSXGLTOVSA-N |
|---|
| SMILES | CC1(C)OC2CC3C4CC(F)C5=CC(=O)C=CC5(C)C4(Cl)C(Cl)CC3(C)C2(C(=O)CF)O1 |
|---|
Synonyms
| Tralonide (USAN/INN) |
| Tralonidum [INN-Latin] |
| UNII-38ETX8IT42 |
| Tralonida [INN-Spanish] |
| Tralonidum |
| Tralonida |
